C15H30N2O4 — CID 167281122
3-[3-(3-formamido-3-methylbutoxy)-3-methylbutoxy]-N-methylpropanamide (PubChem CID 167281122) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[3-(3-formamido-3-methylbutoxy)-3-methylbutoxy]-N-methylpropanamide.
| Compound Name | 3-[3-(3-formamido-3-methylbutoxy)-3-methylbutoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 167281122 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3-[3-(3-formamido-3-methylbutoxy)-3-methylbutoxy]-N-methylpropanamide |
| SMILES | CNC(=O)CCOCCC(C)(C)OCCC(C)(C)NC=O |
| InChI | InChI=1S/C15H30N2O4/c1-14(2,17-12-18)7-11-21-15(3,4)8-10-20-9-6-13(19)16-5/h12H,6-11H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | GXAUQBOECXMEKD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|