C18H38N4O5 — CID 170237256
N'-[2-[[3-[2-(2-aminoethoxy)ethoxy]-3-methylbutoxy]-methylamino]ethyl]-N-methylpentanediamide (PubChem CID 170237256) has the molecular formula C18H38N4O5 and a molecular weight of 390.53 g/mol. Its IUPAC name is N'-[2-[[3-[2-(2-aminoethoxy)ethoxy]-3-methylbutoxy]-methylamino]ethyl]-N-methylpentanediamide.
| Compound Name | N'-[2-[[3-[2-(2-aminoethoxy)ethoxy]-3-methylbutoxy]-methylamino]ethyl]-N-methylpentanediamide |
|---|---|
| PubChem CID | 170237256 |
| Molecular Formula | C18H38N4O5 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | N'-[2-[[3-[2-(2-aminoethoxy)ethoxy]-3-methylbutoxy]-methylamino]ethyl]-N-methylpentanediamide |
| SMILES | CNC(=O)CCCC(=O)NCCN(C)OCCC(C)(C)OCCOCCN |
| InChI | InChI=1S/C18H38N4O5/c1-18(2,26-15-14-25-13-9-19)8-12-27-22(4)11-10-21-17(24)7-5-6-16(23)20-3/h5-15,19H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | PFUJUOFXRJYLKJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|