C17H34IN3O6 — CID 155261158
4-[iodo(methyl)amino]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 155261158) has the molecular formula C17H34IN3O6 and a molecular weight of 503.38 g/mol. Its IUPAC name is 4-[iodo(methyl)amino]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 4-[iodo(methyl)amino]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 155261158 |
| Molecular Formula | C17H34IN3O6 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-[iodo(methyl)amino]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CNC(=O)CCOCCOCCOCCOCCNC(=O)CCCN(C)I |
| InChI | InChI=1S/C17H34IN3O6/c1-19-16(22)5-8-24-10-12-26-14-15-27-13-11-25-9-6-20-17(23)4-3-7-21(2)18/h3-15H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | LELRBXVNIHILHD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|