C19H38N2O4 — CID 144763173
N-[2-[2-methyl-4-[2-methyl-4-(methylamino)butan-2-yl]oxybutan-2-yl]oxyethyl]-5-oxohexanamide (PubChem CID 144763173) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is N-[2-[2-methyl-4-[2-methyl-4-(methylamino)butan-2-yl]oxybutan-2-yl]oxyethyl]-5-oxohexanamide.
| Compound Name | N-[2-[2-methyl-4-[2-methyl-4-(methylamino)butan-2-yl]oxybutan-2-yl]oxyethyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 144763173 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | N-[2-[2-methyl-4-[2-methyl-4-(methylamino)butan-2-yl]oxybutan-2-yl]oxyethyl]-5-oxohexanamide |
| SMILES | CNCCC(C)(C)OCCC(C)(C)OCCNC(=O)CCCC(C)=O |
| InChI | InChI=1S/C19H38N2O4/c1-16(22)8-7-9-17(23)21-13-15-25-19(4,5)11-14-24-18(2,3)10-12-20-6/h20H,7-15H2,1-6H3,(H,21,23) |
| InChIKey | AUUCCYJXPJNMJG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|