C34H68N2O8 — CID 170374124
N-[3-[3-(methoxymethoxy)-3-methylbutoxy]-3-methylbutyl]-N'-[3-methyl-3-[3-methyl-3-(propan-2-yloxymethoxy)butoxy]butyl]octanediamide (PubChem CID 170374124) has the molecular formula C34H68N2O8 and a molecular weight of 632.92 g/mol. Its IUPAC name is N-[3-[3-(methoxymethoxy)-3-methylbutoxy]-3-methylbutyl]-N'-[3-methyl-3-[3-methyl-3-(propan-2-yloxymethoxy)butoxy]butyl]octanediamide.
| Compound Name | N-[3-[3-(methoxymethoxy)-3-methylbutoxy]-3-methylbutyl]-N'-[3-methyl-3-[3-methyl-3-(propan-2-yloxymethoxy)butoxy]butyl]octanediamide |
|---|---|
| PubChem CID | 170374124 |
| Molecular Formula | C34H68N2O8 |
| Molecular Weight | 632.92 g/mol |
| Exact Mass | 632.50 |
| IUPAC Name | N-[3-[3-(methoxymethoxy)-3-methylbutoxy]-3-methylbutyl]-N'-[3-methyl-3-[3-methyl-3-(propan-2-yloxymethoxy)butoxy]butyl]octanediamide |
| SMILES | COCOC(C)(C)CCOC(C)(C)CCNC(=O)CCCCCCC(=O)NCCC(C)(C)OCCC(C)(C)OCOC(C)C |
| InChI | InChI=1S/C34H68N2O8/c1-28(2)40-27-44-34(9,10)21-25-42-32(5,6)19-23-36-30(38)17-15-13-12-14-16-29(37)35-22-18-31(3,4)41-24-20-33(7,8)43-26-39-11/h28H,12-27H2,1-11H3,(H,35,37)(H,36,38) |
| InChIKey | IYOXBJQKXBNXSU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.92 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|