C19H37NO3 — CID 143768089
ethane;7-(3-methoxy-3-methylbutoxy)-N-prop-2-ynyloctanamide (PubChem CID 143768089) has the molecular formula C19H37NO3 and a molecular weight of 327.51 g/mol. Its IUPAC name is ethane;7-(3-methoxy-3-methylbutoxy)-N-prop-2-ynyloctanamide.
| Compound Name | ethane;7-(3-methoxy-3-methylbutoxy)-N-prop-2-ynyloctanamide |
|---|---|
| PubChem CID | 143768089 |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | ethane;7-(3-methoxy-3-methylbutoxy)-N-prop-2-ynyloctanamide |
| SMILES | C#CCNC(=O)CCCCCC(C)OCCC(C)(C)OC.CC |
| InChI | InChI=1S/C17H31NO3.C2H6/c1-6-13-18-16(19)11-9-7-8-10-15(2)21-14-12-17(3,4)20-5;1-2/h1,15H,7-14H2,2-5H3,(H,18,19);1-2H3 |
| InChIKey | TYTMAXCJFVOFGX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|