C10H18NO4P — CID 122427742
methyl-[6-oxo-6-(prop-2-ynylamino)hexoxy]phosphinic acid (PubChem CID 122427742) has the molecular formula C10H18NO4P and a molecular weight of 247.23 g/mol. Its IUPAC name is methyl-[6-oxo-6-(prop-2-ynylamino)hexoxy]phosphinic acid.
| Compound Name | methyl-[6-oxo-6-(prop-2-ynylamino)hexoxy]phosphinic acid |
|---|---|
| PubChem CID | 122427742 |
| Molecular Formula | C10H18NO4P |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | methyl-[6-oxo-6-(prop-2-ynylamino)hexoxy]phosphinic acid |
| SMILES | C#CCNC(=O)CCCCCOP(C)(=O)O |
| InChI | InChI=1S/C10H18NO4P/c1-3-8-11-10(12)7-5-4-6-9-15-16(2,13)14/h1H,4-9H2,2H3,(H,11,12)(H,13,14) |
| InChIKey | RPQLHPNCSIGMMX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|