C27H40N4O6PS- — CID 155617879
4-[5-[oxido(propan-2-yl)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-3-(prop-2-ynylamino)propyl]-N,N'-bis(prop-2-ynyl)heptanediamide (PubChem CID 155617879) has the molecular formula C27H40N4O6PS- and a molecular weight of 579.68 g/mol. Its IUPAC name is 4-[5-[oxido(propan-2-yl)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-3-(prop-2-ynylamino)propyl]-N,N'-bis(prop-2-ynyl)heptanediamide.
| Compound Name | 4-[5-[oxido(propan-2-yl)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-3-(prop-2-ynylamino)propyl]-N,N'-bis(prop-2-ynyl)heptanediamide |
|---|---|
| PubChem CID | 155617879 |
| Molecular Formula | C27H40N4O6PS- |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 4-[5-[oxido(propan-2-yl)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-3-(prop-2-ynylamino)propyl]-N,N'-bis(prop-2-ynyl)heptanediamide |
| SMILES | C#CCNC(=O)CCC(CCC(=O)NCC#C)(CCC(=O)NCC#C)NC(=O)CCCCOP([O-])(=S)C(C)C |
| InChI | InChI=1S/C27H41N4O6PS/c1-6-18-28-23(32)12-15-27(16-13-24(33)29-19-7-2,17-14-25(34)30-20-8-3)31-26(35)11-9-10-21-37-38(36,39)22(4)5/h1-3,22H,9-21H2,4-5H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35)(H,36,39)/p-1 |
| InChIKey | NNWWDZRDIVMWCX-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|