C41H67N3O12PS- — CID 161346852
4-[5-[tert-butyl(oxido)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-6-(2-prop-2-ynoxyethoxy)hexyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide (PubChem CID 161346852) has the molecular formula C41H67N3O12PS- and a molecular weight of 857.04 g/mol. Its IUPAC name is 4-[5-[tert-butyl(oxido)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-6-(2-prop-2-ynoxyethoxy)hexyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide.
| Compound Name | 4-[5-[tert-butyl(oxido)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-6-(2-prop-2-ynoxyethoxy)hexyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
|---|---|
| PubChem CID | 161346852 |
| Molecular Formula | C41H67N3O12PS- |
| Molecular Weight | 857.04 g/mol |
| Exact Mass | 856.42 |
| IUPAC Name | 4-[5-[tert-butyl(oxido)phosphinothioyl]oxypentanoylamino]-4-[3-oxo-6-(2-prop-2-ynoxyethoxy)hexyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
| SMILES | C#CCOCCOCCCC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)CCCCOP([O-])(=S)C(C)(C)C |
| InChI | InChI=1S/C41H68N3O12PS/c1-7-23-50-30-33-53-26-12-13-36(45)15-18-41(19-16-37(46)42-21-28-54-34-31-51-24-8-2,20-17-38(47)43-22-29-55-35-32-52-25-9-3)44-39(48)14-10-11-27-56-57(49,58)40(4,5)6/h1-3H,10-35H2,4-6H3,(H,42,46)(H,43,47)(H,44,48)(H,49,58)/p-1 |
| InChIKey | VNKMUVRUCXBZAX-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 192.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.04 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|