C29H54N4O8 — CID 154643325
N'-[4-ethyl-8-hydroxy-1-oxo-1-[2-(2-prop-2-ynoxyethoxy)ethylamino]octan-4-yl]-N-(6-hydroxyhexyl)pentanediamide;formamide (PubChem CID 154643325) has the molecular formula C29H54N4O8 and a molecular weight of 586.77 g/mol. Its IUPAC name is N'-[4-ethyl-8-hydroxy-1-oxo-1-[2-(2-prop-2-ynoxyethoxy)ethylamino]octan-4-yl]-N-(6-hydroxyhexyl)pentanediamide;formamide.
| Compound Name | N'-[4-ethyl-8-hydroxy-1-oxo-1-[2-(2-prop-2-ynoxyethoxy)ethylamino]octan-4-yl]-N-(6-hydroxyhexyl)pentanediamide;formamide |
|---|---|
| PubChem CID | 154643325 |
| Molecular Formula | C29H54N4O8 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | N'-[4-ethyl-8-hydroxy-1-oxo-1-[2-(2-prop-2-ynoxyethoxy)ethylamino]octan-4-yl]-N-(6-hydroxyhexyl)pentanediamide;formamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(CC)(CCCCO)NC(=O)CCCC(=O)NCCCCCCO.NC=O |
| InChI | InChI=1S/C28H51N3O7.CH3NO/c1-3-21-37-23-24-38-22-18-30-26(35)14-16-28(4-2,15-7-10-20-33)31-27(36)13-11-12-25(34)29-17-8-5-6-9-19-32;2-1-3/h1,32-33H,4-24H2,2H3,(H,29,34)(H,30,35)(H,31,36);1H,(H2,2,3) |
| InChIKey | BSDSMVVNYOTQPU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 189.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|