C37H60N4O13P+ — CID 153356465
[5-[[6-formyl-1-oxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-hydroxy-oxophosphanium (PubChem CID 153356465) has the molecular formula C37H60N4O13P+ and a molecular weight of 799.88 g/mol. Its IUPAC name is [5-[[6-formyl-1-oxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-hydroxy-oxophosphanium.
| Compound Name | [5-[[6-formyl-1-oxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 153356465 |
| Molecular Formula | C37H60N4O13P+ |
| Molecular Weight | 799.88 g/mol |
| Exact Mass | 799.39 |
| IUPAC Name | [5-[[6-formyl-1-oxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-hydroxy-oxophosphanium |
| SMILES | C#CCOCCOCCNCC(C=O)CC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)CCCCO[P+](=O)O |
| InChI | InChI=1S/C37H59N4O13P/c1-4-17-48-24-27-51-21-14-38-31-33(32-42)30-37(41-36(45)9-7-8-20-54-55(46)47,12-10-34(43)39-15-22-52-28-25-49-18-5-2)13-11-35(44)40-16-23-53-29-26-50-19-6-3/h1-3,32-33,38H,7-31H2,(H3-,39,40,41,43,44,45,46,47)/p+1 |
| InChIKey | WMLIHNDXLTWRJF-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.88 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|