C41H69N4O12PS — CID 155330901
4-[5-[tert-butyl(methylsulfanyl)phosphoryl]oxypentanoylamino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide (PubChem CID 155330901) has the molecular formula C41H69N4O12PS and a molecular weight of 873.06 g/mol. Its IUPAC name is 4-[5-[tert-butyl(methylsulfanyl)phosphoryl]oxypentanoylamino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide.
| Compound Name | 4-[5-[tert-butyl(methylsulfanyl)phosphoryl]oxypentanoylamino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
|---|---|
| PubChem CID | 155330901 |
| Molecular Formula | C41H69N4O12PS |
| Molecular Weight | 873.06 g/mol |
| Exact Mass | 872.44 |
| IUPAC Name | 4-[5-[tert-butyl(methylsulfanyl)phosphoryl]oxypentanoylamino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)CCCCOP(=O)(SC)C(C)(C)C |
| InChI | InChI=1S/C41H69N4O12PS/c1-8-23-51-30-33-54-27-20-42-36(46)14-17-41(18-15-37(47)43-21-28-55-34-31-52-24-9-2,19-16-38(48)44-22-29-56-35-32-53-25-10-3)45-39(49)13-11-12-26-57-58(50,59-7)40(4,5)6/h1-3H,11-35H2,4-7H3,(H,42,46)(H,43,47)(H,44,48)(H,45,49) |
| InChIKey | JFWYQMZKIUXSDO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 198.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|