C39H57N4O13P — CID 146478608
[4-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]-methylphosphinic acid (PubChem CID 146478608) has the molecular formula C39H57N4O13P and a molecular weight of 820.87 g/mol. Its IUPAC name is [4-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]-methylphosphinic acid.
| Compound Name | [4-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 146478608 |
| Molecular Formula | C39H57N4O13P |
| Molecular Weight | 820.87 g/mol |
| Exact Mass | 820.37 |
| IUPAC Name | [4-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]-methylphosphinic acid |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)c1ccc(OP(C)(=O)O)cc1 |
| InChI | InChI=1S/C39H57N4O13P/c1-5-21-50-27-30-53-24-18-40-35(44)12-15-39(16-13-36(45)41-19-25-54-31-28-51-22-6-2,17-14-37(46)42-20-26-55-32-29-52-23-7-3)43-38(47)33-8-10-34(11-9-33)56-57(4,48)49/h1-3,8-11H,12-32H2,4H3,(H,40,44)(H,41,45)(H,42,46)(H,43,47)(H,48,49) |
| InChIKey | NKSAWUDYTXIYPF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.87 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|