C37H61N4O13P — CID 142583423
[5-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-methylphosphinic acid (PubChem CID 142583423) has the molecular formula C37H61N4O13P and a molecular weight of 800.88 g/mol. Its IUPAC name is [5-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-methylphosphinic acid.
| Compound Name | [5-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 142583423 |
| Molecular Formula | C37H61N4O13P |
| Molecular Weight | 800.88 g/mol |
| Exact Mass | 800.40 |
| IUPAC Name | [5-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]amino]-5-oxopentoxy]-methylphosphinic acid |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)CCCCOP(C)(=O)O |
| InChI | InChI=1S/C37H61N4O13P/c1-5-20-48-27-30-51-24-17-38-33(42)11-14-37(41-36(45)10-8-9-23-54-55(4,46)47,15-12-34(43)39-18-25-52-31-28-49-21-6-2)16-13-35(44)40-19-26-53-32-29-50-22-7-3/h1-3H,8-32H2,4H3,(H,38,42)(H,39,43)(H,40,44)(H,41,45)(H,46,47) |
| InChIKey | RRWUYBVLYKSWCX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.88 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|