C25H41N5O8 — CID 176708779
4-[5-(2-cyanoethoxyamino)oxypentanoylamino]-4-(3-oxopropyl)-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide (PubChem CID 176708779) has the molecular formula C25H41N5O8 and a molecular weight of 539.63 g/mol. Its IUPAC name is 4-[5-(2-cyanoethoxyamino)oxypentanoylamino]-4-(3-oxopropyl)-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide.
| Compound Name | 4-[5-(2-cyanoethoxyamino)oxypentanoylamino]-4-(3-oxopropyl)-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
|---|---|
| PubChem CID | 176708779 |
| Molecular Formula | C25H41N5O8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 4-[5-(2-cyanoethoxyamino)oxypentanoylamino]-4-(3-oxopropyl)-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC=O)(CCC(N)=O)NC(=O)CCCCONOCCC#N |
| InChI | InChI=1S/C25H41N5O8/c1-2-16-35-20-21-36-19-14-28-23(33)9-12-25(10-5-15-31,11-8-22(27)32)29-24(34)7-3-4-17-37-30-38-18-6-13-26/h1,15,30H,3-12,14,16-21H2,(H2,27,32)(H,28,33)(H,29,34) |
| InChIKey | RVYGZAPYPOOPHC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 191.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|