C25H48NO4P — CID 160766083
methyl-[6-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]hexoxy]phosphinic acid (PubChem CID 160766083) has the molecular formula C25H48NO4P and a molecular weight of 457.64 g/mol. Its IUPAC name is methyl-[6-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]hexoxy]phosphinic acid.
| Compound Name | methyl-[6-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]hexoxy]phosphinic acid |
|---|---|
| PubChem CID | 160766083 |
| Molecular Formula | C25H48NO4P |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | methyl-[6-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]hexoxy]phosphinic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCCCCCOP(C)(=O)O |
| InChI | InChI=1S/C25H48NO4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-25(27)26-23-20-17-18-21-24-30-31(2,28)29/h7-8,10-11H,3-6,9,12-24H2,1-2H3,(H,26,27)(H,28,29)/b8-7-,11-10- |
| InChIKey | OAMFYMWFAUJPRW-NQLNTKRDSA-N |
| XLogP | 7.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|