C22H42NO7PS — CID 163441376
methyl-[8-[2-[(10-methylsulfanyl-8-oxodecanoyl)amino]ethoxy]-8-oxooctoxy]phosphinic acid (PubChem CID 163441376) has the molecular formula C22H42NO7PS and a molecular weight of 495.62 g/mol. Its IUPAC name is methyl-[8-[2-[(10-methylsulfanyl-8-oxodecanoyl)amino]ethoxy]-8-oxooctoxy]phosphinic acid.
| Compound Name | methyl-[8-[2-[(10-methylsulfanyl-8-oxodecanoyl)amino]ethoxy]-8-oxooctoxy]phosphinic acid |
|---|---|
| PubChem CID | 163441376 |
| Molecular Formula | C22H42NO7PS |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl-[8-[2-[(10-methylsulfanyl-8-oxodecanoyl)amino]ethoxy]-8-oxooctoxy]phosphinic acid |
| SMILES | CSCCC(=O)CCCCCCC(=O)NCCOC(=O)CCCCCCCOP(C)(=O)O |
| InChI | InChI=1S/C22H42NO7PS/c1-31(27,28)30-17-11-7-3-4-10-14-22(26)29-18-16-23-21(25)13-9-6-5-8-12-20(24)15-19-32-2/h3-19H2,1-2H3,(H,23,25)(H,27,28) |
| InChIKey | AZXSHYRZXPBSRS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|