C21H44KNO10P2S2 — CID 162033764
potassium;hydride;[10-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]disulfanyl]-8-oxodecyl] methyl hydrogen phosphate (PubChem CID 162033764) has the molecular formula C21H44KNO10P2S2 and a molecular weight of 635.76 g/mol. Its IUPAC name is potassium;hydride;[10-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]disulfanyl]-8-oxodecyl] methyl hydrogen phosphate.
| Compound Name | potassium;hydride;[10-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]disulfanyl]-8-oxodecyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 162033764 |
| Molecular Formula | C21H44KNO10P2S2 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | potassium;hydride;[10-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]disulfanyl]-8-oxodecyl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCCCCCCC(=O)CCSSCCC(=O)NCCCCCCOP(=O)(O)OC.[H-].[K+] |
| InChI | InChI=1S/C21H43NO10P2S2.K.H/c1-29-33(25,26)31-16-10-6-3-4-8-12-20(23)13-18-35-36-19-14-21(24)22-15-9-5-7-11-17-32-34(27,28)30-2;;/h3-19H2,1-2H3,(H,22,24)(H,25,26)(H,27,28);;/q;+1;-1 |
| InChIKey | BXTBVCXGUWPBIF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|