C15H30N2O4S2 — CID 162123460
N-[2-(2-aminoethyldisulfanyl)ethyl]-8-(2-methoxyethoxy)-4-oxooctanamide (PubChem CID 162123460) has the molecular formula C15H30N2O4S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-8-(2-methoxyethoxy)-4-oxooctanamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-8-(2-methoxyethoxy)-4-oxooctanamide |
|---|---|
| PubChem CID | 162123460 |
| Molecular Formula | C15H30N2O4S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-8-(2-methoxyethoxy)-4-oxooctanamide |
| SMILES | COCCOCCCCC(=O)CCC(=O)NCCSSCCN |
| InChI | InChI=1S/C15H30N2O4S2/c1-20-10-11-21-9-3-2-4-14(18)5-6-15(19)17-8-13-23-22-12-7-16/h2-13,16H2,1H3,(H,17,19) |
| InChIKey | IHTHKMMUUXHFTN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|