C14H26N2O4S2 — CID 59146433
methyl 5-[4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-1-enoxy]pentanoate (PubChem CID 59146433) has the molecular formula C14H26N2O4S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is methyl 5-[4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-1-enoxy]pentanoate.
| Compound Name | methyl 5-[4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-1-enoxy]pentanoate |
|---|---|
| PubChem CID | 59146433 |
| Molecular Formula | C14H26N2O4S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 5-[4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-1-enoxy]pentanoate |
| SMILES | COC(=O)CCCCOC=CCC(=O)NCCSSCCN |
| InChI | InChI=1S/C14H26N2O4S2/c1-19-14(18)6-2-3-9-20-10-4-5-13(17)16-8-12-22-21-11-7-15/h4,10H,2-3,5-9,11-12,15H2,1H3,(H,16,17) |
| InChIKey | LVKNNXDQTOSAGW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|