C6H15N3O2S2 — CID 87922080
N-[2-(2-aminoethyldisulfanyl)ethyl]-2-aminooxyacetamide (PubChem CID 87922080) has the molecular formula C6H15N3O2S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-2-aminooxyacetamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-2-aminooxyacetamide |
|---|---|
| PubChem CID | 87922080 |
| Molecular Formula | C6H15N3O2S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-2-aminooxyacetamide |
| SMILES | NCCSSCCNC(=O)CON |
| InChI | InChI=1S/C6H15N3O2S2/c7-1-3-12-13-4-2-9-6(10)5-11-8/h1-5,7-8H2,(H,9,10) |
| InChIKey | DHMBHNYOCRYSBL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|