C9H16N2O3S2 — CID 173062524
methyl 4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-2-enoate (PubChem CID 173062524) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173062524 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | methyl 4-[2-(2-aminoethyldisulfanyl)ethylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)C=CC(=O)NCCSSCCN |
| InChI | InChI=1S/C9H16N2O3S2/c1-14-9(13)3-2-8(12)11-5-7-16-15-6-4-10/h2-3H,4-7,10H2,1H3,(H,11,12) |
| InChIKey | LOEXKTYAJHCWNU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|