C18H28N2O6 — CID 11793380
propyl (E)-4-oxo-4-[4-[[(E)-4-oxo-4-propoxybut-2-enoyl]amino]butylamino]but-2-enoate (PubChem CID 11793380) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is propyl (E)-4-oxo-4-[4-[[(E)-4-oxo-4-propoxybut-2-enoyl]amino]butylamino]but-2-enoate.
| Compound Name | propyl (E)-4-oxo-4-[4-[[(E)-4-oxo-4-propoxybut-2-enoyl]amino]butylamino]but-2-enoate |
|---|---|
| PubChem CID | 11793380 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | propyl (E)-4-oxo-4-[4-[[(E)-4-oxo-4-propoxybut-2-enoyl]amino]butylamino]but-2-enoate |
| SMILES | CCCOC(=O)/C=C/C(=O)NCCCCNC(=O)/C=C/C(=O)OCCC |
| InChI | InChI=1S/C18H28N2O6/c1-3-13-25-17(23)9-7-15(21)19-11-5-6-12-20-16(22)8-10-18(24)26-14-4-2/h7-10H,3-6,11-14H2,1-2H3,(H,19,21)(H,20,22)/b9-7+,10-8+ |
| InChIKey | OTWHMUNFIAQCLF-FIFLTTCUSA-N |
| XLogP | 1.02 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|