C7H9NO4S — CID 140741785
2-[(4-methoxy-4-oxobut-2-enoyl)amino]ethanethioic S-acid (PubChem CID 140741785) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-[(4-methoxy-4-oxobut-2-enoyl)amino]ethanethioic S-acid.
| Compound Name | 2-[(4-methoxy-4-oxobut-2-enoyl)amino]ethanethioic S-acid |
|---|---|
| PubChem CID | 140741785 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-[(4-methoxy-4-oxobut-2-enoyl)amino]ethanethioic S-acid |
| SMILES | COC(=O)C=CC(=O)NCC(=O)S |
| InChI | InChI=1S/C7H9NO4S/c1-12-6(10)3-2-5(9)8-4-7(11)13/h2-3H,4H2,1H3,(H,8,9)(H,11,13) |
| InChIKey | BIQXOMQZZULDLM-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|