C13H25NO5Si — CID 59083277
methyl (E)-4-[3-[diethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoate (PubChem CID 59083277) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is methyl (E)-4-[3-[diethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[3-[diethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 59083277 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl (E)-4-[3-[diethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoate |
| SMILES | CCO[Si](C)(CCCNC(=O)/C=C/C(=O)OC)OCC |
| InChI | InChI=1S/C13H25NO5Si/c1-5-18-20(4,19-6-2)11-7-10-14-12(15)8-9-13(16)17-3/h8-9H,5-7,10-11H2,1-4H3,(H,14,15)/b9-8+ |
| InChIKey | YFGILPOKSPHMCG-CMDGGOBGSA-N |
| XLogP | 1.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|