C9H19NO3Si — CID 23152140
N-[3-[dimethoxy(methyl)silyl]propyl]prop-2-enamide (PubChem CID 23152140) has the molecular formula C9H19NO3Si and a molecular weight of 217.34 g/mol. Its IUPAC name is N-[3-[dimethoxy(methyl)silyl]propyl]prop-2-enamide.
| Compound Name | N-[3-[dimethoxy(methyl)silyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 23152140 |
| Molecular Formula | C9H19NO3Si |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[3-[dimethoxy(methyl)silyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C9H19NO3Si/c1-5-9(11)10-7-6-8-14(4,12-2)13-3/h5H,1,6-8H2,2-4H3,(H,10,11) |
| InChIKey | GUNSHNXZPCSGAU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|