C9H19NO4Si — CID 59383622
[3-[dimethoxy(methyl)silyl]propylamino] prop-2-enoate (PubChem CID 59383622) has the molecular formula C9H19NO4Si and a molecular weight of 233.34 g/mol. Its IUPAC name is [3-[dimethoxy(methyl)silyl]propylamino] prop-2-enoate.
| Compound Name | [3-[dimethoxy(methyl)silyl]propylamino] prop-2-enoate |
|---|---|
| PubChem CID | 59383622 |
| Molecular Formula | C9H19NO4Si |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [3-[dimethoxy(methyl)silyl]propylamino] prop-2-enoate |
| SMILES | C=CC(=O)ONCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C9H19NO4Si/c1-5-9(11)14-10-7-6-8-15(4,12-2)13-3/h5,10H,1,6-8H2,2-4H3 |
| InChIKey | HBBQGZZUUKZJBK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|