C10H19NO5Si — CID 174032211
(E)-4-[3-[dimethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoic acid (PubChem CID 174032211) has the molecular formula C10H19NO5Si and a molecular weight of 261.35 g/mol. Its IUPAC name is (E)-4-[3-[dimethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[dimethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 174032211 |
| Molecular Formula | C10H19NO5Si |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (E)-4-[3-[dimethoxy(methyl)silyl]propylamino]-4-oxobut-2-enoic acid |
| SMILES | CO[Si](C)(CCCNC(=O)/C=C/C(=O)O)OC |
| InChI | InChI=1S/C10H19NO5Si/c1-15-17(3,16-2)8-4-7-11-9(12)5-6-10(13)14/h5-6H,4,7-8H2,1-3H3,(H,11,12)(H,13,14)/b6-5+ |
| InChIKey | CVOPHZFPUVSJKC-AATRIKPKSA-N |
| XLogP | 0.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|