C26H44N2O10Si2 — CID 166567624
2,5-bis[3-[diethoxy(methyl)silyl]propylcarbamoyl]terephthalic acid (PubChem CID 166567624) has the molecular formula C26H44N2O10Si2 and a molecular weight of 600.81 g/mol. Its IUPAC name is 2,5-bis[3-[diethoxy(methyl)silyl]propylcarbamoyl]terephthalic acid.
| Compound Name | 2,5-bis[3-[diethoxy(methyl)silyl]propylcarbamoyl]terephthalic acid |
|---|---|
| PubChem CID | 166567624 |
| Molecular Formula | C26H44N2O10Si2 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 2,5-bis[3-[diethoxy(methyl)silyl]propylcarbamoyl]terephthalic acid |
| SMILES | CCO[Si](C)(CCCNC(=O)c1cc(C(=O)O)c(C(=O)NCCC[Si](C)(OCC)OCC)cc1C(=O)O)OCC |
| InChI | InChI=1S/C26H44N2O10Si2/c1-7-35-39(5,36-8-2)15-11-13-27-23(29)19-17-22(26(33)34)20(18-21(19)25(31)32)24(30)28-14-12-16-40(6,37-9-3)38-10-4/h17-18H,7-16H2,1-6H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChIKey | NHSDJCWUSMRHAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|