C17H27NO7Si — CID 102404606
2-hydroxy-6-(3-triethoxysilylpropylcarbamoyl)benzoic acid (PubChem CID 102404606) has the molecular formula C17H27NO7Si and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-hydroxy-6-(3-triethoxysilylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-hydroxy-6-(3-triethoxysilylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 102404606 |
| Molecular Formula | C17H27NO7Si |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-hydroxy-6-(3-triethoxysilylpropylcarbamoyl)benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)c1cccc(O)c1C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C17H27NO7Si/c1-4-23-26(24-5-2,25-6-3)12-8-11-18-16(20)13-9-7-10-14(19)15(13)17(21)22/h7,9-10,19H,4-6,8,11-12H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | BIXNHMWQEUDXCZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|