C35H58N2O13Si2 — CID 123489026
5-[(S)-[3-(dihydroxymethyl)-4-(3-triethoxysilylpropylcarbamoyl)phenyl]-hydroxymethyl]-2-[(S)-hydroxy-(3-triethoxysilylpropylamino)methyl]benzoic acid (PubChem CID 123489026) has the molecular formula C35H58N2O13Si2 and a molecular weight of 771.02 g/mol. Its IUPAC name is 5-[(S)-[3-(dihydroxymethyl)-4-(3-triethoxysilylpropylcarbamoyl)phenyl]-hydroxymethyl]-2-[(S)-hydroxy-(3-triethoxysilylpropylamino)methyl]benzoic acid.
| Compound Name | 5-[(S)-[3-(dihydroxymethyl)-4-(3-triethoxysilylpropylcarbamoyl)phenyl]-hydroxymethyl]-2-[(S)-hydroxy-(3-triethoxysilylpropylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 123489026 |
| Molecular Formula | C35H58N2O13Si2 |
| Molecular Weight | 771.02 g/mol |
| Exact Mass | 770.35 |
| IUPAC Name | 5-[(S)-[3-(dihydroxymethyl)-4-(3-triethoxysilylpropylcarbamoyl)phenyl]-hydroxymethyl]-2-[(S)-hydroxy-(3-triethoxysilylpropylamino)methyl]benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)c1ccc([C@H](O)c2ccc([C@H](O)NCCC[Si](OCC)(OCC)OCC)c(C(=O)O)c2)cc1C(O)O)(OCC)OCC |
| InChI | InChI=1S/C35H58N2O13Si2/c1-7-45-51(46-8-2,47-9-3)21-13-19-36-32(39)27-17-15-25(23-29(27)34(41)42)31(38)26-16-18-28(30(24-26)35(43)44)33(40)37-20-14-22-52(48-10-4,49-11-5)50-12-6/h15-18,23-24,31-32,35-36,38-39,43-44H,7-14,19-22H2,1-6H3,(H,37,40)(H,41,42)/t31-,32+/m1/s1 |
| InChIKey | OWXZSVWLMQHPQO-ZWXJPIIXSA-N |
| XLogP | 3.64 |
| TPSA | 214.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.02 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|