C28H40N2O12Si2 — CID 174032167
5-[4-carboxy-3-(3-trimethoxysilylpropylcarbamoyl)phenyl]-2-(3-trimethoxysilylpropylcarbamoyl)benzoic acid (PubChem CID 174032167) has the molecular formula C28H40N2O12Si2 and a molecular weight of 652.80 g/mol. Its IUPAC name is 5-[4-carboxy-3-(3-trimethoxysilylpropylcarbamoyl)phenyl]-2-(3-trimethoxysilylpropylcarbamoyl)benzoic acid.
| Compound Name | 5-[4-carboxy-3-(3-trimethoxysilylpropylcarbamoyl)phenyl]-2-(3-trimethoxysilylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 174032167 |
| Molecular Formula | C28H40N2O12Si2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 5-[4-carboxy-3-(3-trimethoxysilylpropylcarbamoyl)phenyl]-2-(3-trimethoxysilylpropylcarbamoyl)benzoic acid |
| SMILES | CO[Si](CCCNC(=O)c1ccc(-c2ccc(C(=O)O)c(C(=O)NCCC[Si](OC)(OC)OC)c2)cc1C(=O)O)(OC)OC |
| InChI | InChI=1S/C28H40N2O12Si2/c1-37-43(38-2,39-3)15-7-13-29-25(31)21-11-9-20(18-24(21)28(35)36)19-10-12-22(27(33)34)23(17-19)26(32)30-14-8-16-44(40-4,41-5)42-6/h9-12,17-18H,7-8,13-16H2,1-6H3,(H,29,31)(H,30,32)(H,33,34)(H,35,36) |
| InChIKey | CDZSAVSMLRODSE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 188.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|