C36H56N2O12Si2 — CID 158572965
4-[4-carboxy-3-(4-triethoxysilylbutylcarbamoyl)phenyl]-2-(4-triethoxysilylbutylcarbamoyl)benzoic acid (PubChem CID 158572965) has the molecular formula C36H56N2O12Si2 and a molecular weight of 765.02 g/mol. Its IUPAC name is 4-[4-carboxy-3-(4-triethoxysilylbutylcarbamoyl)phenyl]-2-(4-triethoxysilylbutylcarbamoyl)benzoic acid.
| Compound Name | 4-[4-carboxy-3-(4-triethoxysilylbutylcarbamoyl)phenyl]-2-(4-triethoxysilylbutylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 158572965 |
| Molecular Formula | C36H56N2O12Si2 |
| Molecular Weight | 765.02 g/mol |
| Exact Mass | 764.34 |
| IUPAC Name | 4-[4-carboxy-3-(4-triethoxysilylbutylcarbamoyl)phenyl]-2-(4-triethoxysilylbutylcarbamoyl)benzoic acid |
| SMILES | CCO[Si](CCCCNC(=O)c1cc(-c2ccc(C(=O)O)c(C(=O)NCCCC[Si](OCC)(OCC)OCC)c2)ccc1C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C36H56N2O12Si2/c1-7-45-51(46-8-2,47-9-3)23-15-13-21-37-33(39)31-25-27(17-19-29(31)35(41)42)28-18-20-30(36(43)44)32(26-28)34(40)38-22-14-16-24-52(48-10-4,49-11-5)50-12-6/h17-20,25-26H,7-16,21-24H2,1-6H3,(H,37,39)(H,38,40)(H,41,42)(H,43,44) |
| InChIKey | BCXPVXKDPPSXJA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 188.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|