C37H53N3O10Si — CID 162027729
deuterium monohydride;7-(diethylamino)-2-oxochromene-3-carboxylic acid;7-(diethylamino)-2-oxo-N-(3-triethoxysilylpropyl)chromene-3-carboxamide (PubChem CID 162027729) has the molecular formula C37H53N3O10Si and a molecular weight of 728.93 g/mol. Its IUPAC name is deuterium monohydride;7-(diethylamino)-2-oxochromene-3-carboxylic acid;7-(diethylamino)-2-oxo-N-(3-triethoxysilylpropyl)chromene-3-carboxamide.
| Compound Name | deuterium monohydride;7-(diethylamino)-2-oxochromene-3-carboxylic acid;7-(diethylamino)-2-oxo-N-(3-triethoxysilylpropyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 162027729 |
| Molecular Formula | C37H53N3O10Si |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.36 |
| IUPAC Name | deuterium monohydride;7-(diethylamino)-2-oxochromene-3-carboxylic acid;7-(diethylamino)-2-oxo-N-(3-triethoxysilylpropyl)chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)O)c(=O)oc2c1.CCO[Si](CCCNC(=O)c1cc2ccc(N(CC)CC)cc2oc1=O)(OCC)OCC.[H][2H] |
| InChI | InChI=1S/C23H36N2O6Si.C14H15NO4.H2/c1-6-25(7-2)19-13-12-18-16-20(23(27)31-21(18)17-19)22(26)24-14-11-15-32(28-8-3,29-9-4)30-10-5;1-3-15(4-2)10-6-5-9-7-11(13(16)17)14(18)19-12(9)8-10;/h12-13,16-17H,6-11,14-15H2,1-5H3,(H,24,26);5-8H,3-4H2,1-2H3,(H,16,17);1H/i;;1+1 |
| InChIKey | YVPLAOUSXBPMDR-FCHARDOESA-N |
| XLogP | 6.39 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|