C28H30N2O8 — CID 87060588
7-(diethylamino)-2-oxochromene-3-carboxylic acid (PubChem CID 87060588) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is 7-(diethylamino)-2-oxochromene-3-carboxylic acid.
| Compound Name | 7-(diethylamino)-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 87060588 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 7-(diethylamino)-2-oxochromene-3-carboxylic acid |
| SMILES | CCN(CC)c1ccc2cc(C(=O)O)c(=O)oc2c1.CCN(CC)c1ccc2cc(C(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/2C14H15NO4/c2*1-3-15(4-2)10-6-5-9-7-11(13(16)17)14(18)19-12(9)8-10/h2*5-8H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | OVYDSPUXFKBBHG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|