C22H23N3O3 — CID 5452614
N-[(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]benzamide (PubChem CID 5452614) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]benzamide.
| Compound Name | N-[(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 5452614 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc2cc(/C(C)=N\NC(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H23N3O3/c1-4-25(5-2)18-12-11-17-13-19(22(27)28-20(17)14-18)15(3)23-24-21(26)16-9-7-6-8-10-16/h6-14H,4-5H2,1-3H3,(H,24,26)/b23-15- |
| InChIKey | GOEVDQMMBBSQDH-HAHDFKILSA-N |
| XLogP | 3.79 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|