C16H20N4O2S — CID 5403478
[(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]thiourea (PubChem CID 5403478) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is [(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]thiourea.
| Compound Name | [(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 5403478 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(Z)-1-[7-(diethylamino)-2-oxochromen-3-yl]ethylideneamino]thiourea |
| SMILES | CCN(CC)c1ccc2cc(/C(C)=N\NC(N)=S)c(=O)oc2c1 |
| InChI | InChI=1S/C16H20N4O2S/c1-4-20(5-2)12-7-6-11-8-13(10(3)18-19-16(17)23)15(21)22-14(11)9-12/h6-9H,4-5H2,1-3H3,(H3,17,19,23)/b18-10- |
| InChIKey | DRGHWLNJVCQNKW-ZDLGFXPLSA-N |
| XLogP | 2.20 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|