C22H26N2O2S — CID 143869143
7-(diethylamino)-N-[(2E,5Z)-octa-2,5,7-trien-3-yl]-2-oxochromene-3-carbothioamide (PubChem CID 143869143) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 7-(diethylamino)-N-[(2E,5Z)-octa-2,5,7-trien-3-yl]-2-oxochromene-3-carbothioamide.
| Compound Name | 7-(diethylamino)-N-[(2E,5Z)-octa-2,5,7-trien-3-yl]-2-oxochromene-3-carbothioamide |
|---|---|
| PubChem CID | 143869143 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 7-(diethylamino)-N-[(2E,5Z)-octa-2,5,7-trien-3-yl]-2-oxochromene-3-carbothioamide |
| SMILES | C=C/C=C\C/C(=C\C)NC(=S)c1cc2ccc(N(CC)CC)cc2oc1=O |
| InChI | InChI=1S/C22H26N2O2S/c1-5-9-10-11-17(6-2)23-21(27)19-14-16-12-13-18(24(7-3)8-4)15-20(16)26-22(19)25/h5-6,9-10,12-15H,1,7-8,11H2,2-4H3,(H,23,27)/b10-9-,17-6+ |
| InChIKey | VLCIPWCPHZKEIP-ALPKGXSHSA-N |
| XLogP | 4.94 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|