C18H24N2O4 — CID 54453751
7-(diethylamino)-N-(2-methoxyethyl)-N-methyl-2-oxochromene-3-carboxamide (PubChem CID 54453751) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 7-(diethylamino)-N-(2-methoxyethyl)-N-methyl-2-oxochromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-N-(2-methoxyethyl)-N-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 54453751 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 7-(diethylamino)-N-(2-methoxyethyl)-N-methyl-2-oxochromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)N(C)CCOC)c(=O)oc2c1 |
| InChI | InChI=1S/C18H24N2O4/c1-5-20(6-2)14-8-7-13-11-15(18(22)24-16(13)12-14)17(21)19(3)9-10-23-4/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | WWSZWQYJLGUBLY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|