C18H25N2O7P — CID 25193373
4-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]butyl dihydrogen phosphate (PubChem CID 25193373) has the molecular formula C18H25N2O7P and a molecular weight of 412.38 g/mol. Its IUPAC name is 4-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]butyl dihydrogen phosphate.
| Compound Name | 4-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25193373 |
| Molecular Formula | C18H25N2O7P |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]butyl dihydrogen phosphate |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCCCCOP(=O)(O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C18H25N2O7P/c1-3-20(4-2)14-8-7-13-11-15(18(22)27-16(13)12-14)17(21)19-9-5-6-10-26-28(23,24)25/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,19,21)(H2,23,24,25) |
| InChIKey | CDEUCLQJALAYHC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|