C25H35N3O7 — CID 146446961
6-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 146446961) has the molecular formula C25H35N3O7 and a molecular weight of 489.57 g/mol. Its IUPAC name is 6-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 146446961 |
| Molecular Formula | C25H35N3O7 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 6-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C25H35N3O7/c1-6-28(7-2)17-12-11-16-14-18(23(32)34-20(16)15-17)21(29)26-13-9-8-10-19(22(30)31)27-24(33)35-25(3,4)5/h11-12,14-15,19H,6-10,13H2,1-5H3,(H,26,29)(H,27,33)(H,30,31) |
| InChIKey | JYQZIKXCFUNKOU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|