C32H38N4O8 — CID 155086966
6-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 155086966) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is 6-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 155086966 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 6-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4cc(C(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)O)ccc4o3)c(=O)oc2c1 |
| InChI | InChI=1S/C32H38N4O8/c1-6-36(7-2)21-13-11-19-16-22(30(40)43-26(19)18-21)28-34-24-17-20(12-14-25(24)42-28)27(37)33-15-9-8-10-23(29(38)39)35-31(41)44-32(3,4)5/h11-14,16-18,23H,6-10,15H2,1-5H3,(H,33,37)(H,35,41)(H,38,39) |
| InChIKey | MJWGLJJBFSSLHJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 164.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|