C23H22N2O11S2 — CID 170417572
2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carboxylic acid (PubChem CID 170417572) has the molecular formula C23H22N2O11S2 and a molecular weight of 566.57 g/mol. Its IUPAC name is 2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170417572 |
| Molecular Formula | C23H22N2O11S2 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | 2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2oc(-c3cc4ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc4oc3=O)nc2c1 |
| InChI | InChI=1S/C23H22N2O11S2/c26-22(27)15-4-6-19-18(12-15)24-21(35-19)17-11-14-3-5-16(13-20(14)36-23(17)28)25(7-1-9-37(29,30)31)8-2-10-38(32,33)34/h3-6,11-13H,1-2,7-10H2,(H,26,27)(H,29,30,31)(H,32,33,34) |
| InChIKey | IHLGOPPAMVTDJU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 205.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|