C26H34N2O14S4 — CID 167475290
3-[[6-[bis(3-sulfopropyl)amino]-9,10-dioxoanthracen-2-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid (PubChem CID 167475290) has the molecular formula C26H34N2O14S4 and a molecular weight of 726.83 g/mol. Its IUPAC name is 3-[[6-[bis(3-sulfopropyl)amino]-9,10-dioxoanthracen-2-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[[6-[bis(3-sulfopropyl)amino]-9,10-dioxoanthracen-2-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 167475290 |
| Molecular Formula | C26H34N2O14S4 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | 3-[[6-[bis(3-sulfopropyl)amino]-9,10-dioxoanthracen-2-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid |
| SMILES | O=C1c2ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc2C(=O)c2ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc21 |
| InChI | InChI=1S/C26H34N2O14S4/c29-25-22-8-6-20(28(11-3-15-45(37,38)39)12-4-16-46(40,41)42)18-24(22)26(30)21-7-5-19(17-23(21)25)27(9-1-13-43(31,32)33)10-2-14-44(34,35)36/h5-8,17-18H,1-4,9-16H2,(H,31,32,33)(H,34,35,36)(H,37,38,39)(H,40,41,42) |
| InChIKey | UFUUMVACQNCIPF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 258.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|