C13H21NNaO3S — CID 173362541
CID 173362541 (PubChem CID 173362541) has the molecular formula C13H21NNaO3S and a molecular weight of 294.37 g/mol.
| Compound Name | CID 173362541 |
|---|---|
| PubChem CID | 173362541 |
| Molecular Formula | C13H21NNaO3S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | — |
| SMILES | CCN(CCCS(=O)(=O)O)c1cc(C)cc(C)c1.[Na] |
| InChI | InChI=1S/C13H21NO3S.Na/c1-4-14(6-5-7-18(15,16)17)13-9-11(2)8-12(3)10-13;/h8-10H,4-7H2,1-3H3,(H,15,16,17); |
| InChIKey | WBDPFJNFZAXEBD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|