C15H26NNaO6S2 — CID 173257441
sodium;hydride;4-[3-methyl-N-(4-sulfobutyl)anilino]butane-1-sulfonic acid (PubChem CID 173257441) has the molecular formula C15H26NNaO6S2 and a molecular weight of 403.50 g/mol. Its IUPAC name is sodium;hydride;4-[3-methyl-N-(4-sulfobutyl)anilino]butane-1-sulfonic acid.
| Compound Name | sodium;hydride;4-[3-methyl-N-(4-sulfobutyl)anilino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173257441 |
| Molecular Formula | C15H26NNaO6S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | sodium;hydride;4-[3-methyl-N-(4-sulfobutyl)anilino]butane-1-sulfonic acid |
| SMILES | Cc1cccc(N(CCCCS(=O)(=O)O)CCCCS(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C15H25NO6S2.Na.H/c1-14-7-6-8-15(13-14)16(9-2-4-11-23(17,18)19)10-3-5-12-24(20,21)22;;/h6-8,13H,2-5,9-12H2,1H3,(H,17,18,19)(H,20,21,22);;/q;+1;-1 |
| InChIKey | WJFKQGXLCUWDRV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|