C11H17NO8S2 — CID 88528148
2-[3-methyl-N-(2-sulfooxyethyl)anilino]ethyl hydrogen sulfate (PubChem CID 88528148) has the molecular formula C11H17NO8S2 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[3-methyl-N-(2-sulfooxyethyl)anilino]ethyl hydrogen sulfate.
| Compound Name | 2-[3-methyl-N-(2-sulfooxyethyl)anilino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 88528148 |
| Molecular Formula | C11H17NO8S2 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[3-methyl-N-(2-sulfooxyethyl)anilino]ethyl hydrogen sulfate |
| SMILES | Cc1cccc(N(CCOS(=O)(=O)O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H17NO8S2/c1-10-3-2-4-11(9-10)12(5-7-19-21(13,14)15)6-8-20-22(16,17)18/h2-4,9H,5-8H2,1H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | LFSWZTYJBMIEJH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|