C21H26N4O4S — CID 88819342
4-amino-2,6-dimethylbenzene-1,3-dicarbonitrile;2-(N-ethyl-3-methylanilino)ethyl hydrogen sulfate (PubChem CID 88819342) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-amino-2,6-dimethylbenzene-1,3-dicarbonitrile;2-(N-ethyl-3-methylanilino)ethyl hydrogen sulfate.
| Compound Name | 4-amino-2,6-dimethylbenzene-1,3-dicarbonitrile;2-(N-ethyl-3-methylanilino)ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 88819342 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-amino-2,6-dimethylbenzene-1,3-dicarbonitrile;2-(N-ethyl-3-methylanilino)ethyl hydrogen sulfate |
| SMILES | CCN(CCOS(=O)(=O)O)c1cccc(C)c1.Cc1cc(N)c(C#N)c(C)c1C#N |
| InChI | InChI=1S/C11H17NO4S.C10H9N3/c1-3-12(7-8-16-17(13,14)15)11-6-4-5-10(2)9-11;1-6-3-10(13)9(5-12)7(2)8(6)4-11/h4-6,9H,3,7-8H2,1-2H3,(H,13,14,15);3H,13H2,1-2H3 |
| InChIKey | IFSHLBBLYQILAI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|