C12H19NO4S — CID 139885461
3-(N-ethyl-4-methoxyanilino)propane-1-sulfonic acid (PubChem CID 139885461) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-(N-ethyl-4-methoxyanilino)propane-1-sulfonic acid.
| Compound Name | 3-(N-ethyl-4-methoxyanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139885461 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(N-ethyl-4-methoxyanilino)propane-1-sulfonic acid |
| SMILES | CCN(CCCS(=O)(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H19NO4S/c1-3-13(9-4-10-18(14,15)16)11-5-7-12(17-2)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,14,15,16) |
| InChIKey | VIQBWVCHXAPUIV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|