C33H30N2O6S — CID 146021321
4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)-N-(4-methoxyphenyl)anilino]benzenesulfonic acid (PubChem CID 146021321) has the molecular formula C33H30N2O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is 4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)-N-(4-methoxyphenyl)anilino]benzenesulfonic acid.
| Compound Name | 4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)-N-(4-methoxyphenyl)anilino]benzenesulfonic acid |
|---|---|
| PubChem CID | 146021321 |
| Molecular Formula | C33H30N2O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)-N-(4-methoxyphenyl)anilino]benzenesulfonic acid |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(N(c3ccc(OC)cc3)c3ccc(S(=O)(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O6S/c1-39-30-16-8-26(9-17-30)34(27-10-18-31(40-2)19-11-27)24-4-6-25(7-5-24)35(28-12-20-32(41-3)21-13-28)29-14-22-33(23-15-29)42(36,37)38/h4-23H,1-3H3,(H,36,37,38) |
| InChIKey | NZGSFFWYGIMNBB-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|